CAS 2958-62-5 appears in our catalog under these names: 2,4,6-Trimethylphenyl isocyanate, 95%, 2,4,6–Trimethylphenyl isocyanate, 2,4,6-Trimethylphenyl isocyanate, 98% . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
2-isocyanato-1,3,5-trimethylbenzene (CAS 2958-62-5) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: 2-isocyanato-1,3,5-trimethylbenzene. InChIKey: HJHZRZFONUPQAA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 2-isocyanato-1,3,5-trimethylbenzene |
| InChIKey | HJHZRZFONUPQAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N=C=O)C |
Computed by PubChem (NCBI)