Products 2958-66-9
CAS 2958-66-9 is the registry number for Bicyclo(3.1.0)hexane-1,5-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Bicyclo[3.1.0]hexane-1,5-dicarboxylic acid (CAS 2958-66-9) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: bicyclo[3.1.0]hexane-1,5-dicarboxylic acid. InChIKey: QCRFMOJKZTZIAT-UHFFFAOYSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | bicyclo[3.1.0]hexane-1,5-dicarboxylic acid |
| InChIKey | QCRFMOJKZTZIAT-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2(C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)