Products 2962073-58-9
CAS 2962073-58-9 appears in our catalog under these names: 2-[(2E)-3-[4-(Trifluoromethyl)phenyl]prop-2-enamido]acetic acid, 98%, 2-[(2E)-3-[4-(Trifluoromethyl)phenyl]prop-2-enamido]acetic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
2-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]acetic acid (CAS 2962073-58-9) is a chemical compound with the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. IUPAC name: 2-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]acetic acid. InChIKey: YOPFIFMYAQQVAX-ZZXKWVIFSA-N.
| Molecular formula | C12H10F3NO3 |
|---|---|
| Molecular weight | 273.21 g/mol |
| IUPAC name | 2-[[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]acetic acid |
| InChIKey | YOPFIFMYAQQVAX-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)NCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)