Products 3094-32-4
CAS 3094-32-4 appears in our catalog under these names: 2-Trifluoromethyl-alpha-acetamidocinnamic acid, 95%, 2-Trifluoromethyl-α-acetamidocinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg.
(E)-2-acetamido-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 3094-32-4) is a chemical compound with the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. IUPAC name: (E)-2-acetamido-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: HVLNJIRMSFAIEV-UXBLZVDNSA-N.
| Molecular formula | C12H10F3NO3 |
|---|---|
| Molecular weight | 273.21 g/mol |
| IUPAC name | (E)-2-acetamido-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | HVLNJIRMSFAIEV-UXBLZVDNSA-N |
| SMILES | CC(=O)N/C(=C/C1=CC=CC=C1C(F)(F)F)/C(=O)O |
Computed by PubChem (NCBI)