CAS 2357-26-8 appears in our catalog under these names: 5-Oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid, 98%, 5-Oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid (CAS 2357-26-8) is a chemical compound with the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. IUPAC name: 5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid. InChIKey: LCRHVZDPBWDWSX-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO3 |
|---|---|
| Molecular weight | 273.21 g/mol |
| IUPAC name | 5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
| InChIKey | LCRHVZDPBWDWSX-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC(=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)