Products 296259-54-6
CAS 296259-54-6 appears in our catalog under these names: 2–(Benzylamino)–4–chlorobenzonitrile, 2-(Benzylamino)-4-chlorobenzonitrile. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 2,5g.
2-(benzylamino)-4-chlorobenzonitrile (CAS 296259-54-6) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-(benzylamino)-4-chlorobenzonitrile. InChIKey: PIAZBFBIMPNJHL-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-(benzylamino)-4-chlorobenzonitrile |
| InChIKey | PIAZBFBIMPNJHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CC(=C2)Cl)C#N |
Computed by PubChem (NCBI)