CAS 296261-83-1 appears in our catalog under these names: (2E)-3-[4-Methoxy-3-(morpholin-4-ylsulfonyl)phenyl]acrylic acid, 95%, 3-(4-Methoxy-3-(morpholinosulfonyl)phenyl)acrylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
(E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoic acid (CAS 296261-83-1) is a chemical compound with the molecular formula C14H17NO6S and a molecular weight of 327.35 g/mol. IUPAC name: (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoic acid. InChIKey: OYGGTLFOKHJENI-HWKANZROSA-N.
| Molecular formula | C14H17NO6S |
|---|---|
| Molecular weight | 327.35 g/mol |
| IUPAC name | (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoic acid |
| InChIKey | OYGGTLFOKHJENI-HWKANZROSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O)S(=O)(=O)N2CCOCC2 |
Computed by PubChem (NCBI)