Products 3058450-31-7
CAS 3058450-31-7 appears in our catalog under these names: 1-(4-Methoxybenzyl)-2,6-dioxopiperidin-3-yl methanesulfonate, 98%, 1-(4-Methoxybenzyl)-2,6-dioxopiperidin-3-yl methanesulfonate, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g.
[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl] methanesulfonate (CAS 3058450-31-7) is a chemical compound with the molecular formula C14H17NO6S and a molecular weight of 327.35 g/mol. IUPAC name: [1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl] methanesulfonate. InChIKey: KUTIQMKSEIRIOL-UHFFFAOYSA-N.
| Molecular formula | C14H17NO6S |
|---|---|
| Molecular weight | 327.35 g/mol |
| IUPAC name | [1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl] methanesulfonate |
| InChIKey | KUTIQMKSEIRIOL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)CCC(C2=O)OS(=O)(=O)C |
Computed by PubChem (NCBI)