Products 29636-65-5

CAS 29636-65-5 is the registry number for m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,3-bis(trideuteriomethyl)benzene (CAS 29636-65-5) is a chemical compound with the molecular formula C8H10 and a molecular weight of 112.20 g/mol. IUPAC name: 1,3-bis(trideuteriomethyl)benzene. InChIKey: IVSZLXZYQVIEFR-WFGJKAKNSA-N.

Identity
Molecular formulaC8H10
Molecular weight112.20 g/mol
IUPAC name1,3-bis(trideuteriomethyl)benzene
InChIKeyIVSZLXZYQVIEFR-WFGJKAKNSA-N
SMILES[2H]C([2H])([2H])C1=CC(=CC=C1)C([2H])([2H])[2H]

Computed by PubChem (NCBI)