Products 29668-96-0

CAS 29668-96-0 is the registry number for Diethyl 4,4-dicyanoheptanedioate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 4,4-dicyanoheptanedioate (CAS 29668-96-0) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: diethyl 4,4-dicyanoheptanedioate. InChIKey: AIFUOUBBQRDBED-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O4
Molecular weight266.29 g/mol
IUPAC namediethyl 4,4-dicyanoheptanedioate
InChIKeyAIFUOUBBQRDBED-UHFFFAOYSA-N
SMILESCCOC(=O)CCC(CCC(=O)OCC)(C#N)C#N

Computed by PubChem (NCBI)