Products 296798-88-4
CAS 296798-88-4 is the registry number for TachypleginA-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E,5E)-3,5-dibenzylidene-1-propylpiperidin-4-one (CAS 296798-88-4) is a chemical compound with the molecular formula C22H23NO and a molecular weight of 317.4 g/mol. IUPAC name: (3E,5E)-3,5-dibenzylidene-1-propylpiperidin-4-one. InChIKey: PYSJHLKVOITXQC-OZNQKUEASA-N.
| Molecular formula | C22H23NO |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (3E,5E)-3,5-dibenzylidene-1-propylpiperidin-4-one |
| InChIKey | PYSJHLKVOITXQC-OZNQKUEASA-N |
| SMILES | CCCN1C/C(=C\C2=CC=CC=C2)/C(=O)/C(=C/C3=CC=CC=C3)/C1 |
Computed by PubChem (NCBI)