Products 2968309-12-6
CAS 2968309-12-6 is the registry number for Eupenicisirenin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,6S,7R)-7-(3-methoxy-3-oxopropyl)-7-methylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid (CAS 2968309-12-6) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: (1R,6S,7R)-7-(3-methoxy-3-oxopropyl)-7-methylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid. InChIKey: FVAXAFUDRXJYBC-OPQQBVKSSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (1R,6S,7R)-7-(3-methoxy-3-oxopropyl)-7-methylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid |
| InChIKey | FVAXAFUDRXJYBC-OPQQBVKSSA-N |
| SMILES | C[C@]1([C@@H]2[C@H]1C=C(CC2)C(=O)O)CCC(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Eupenicisirenin C, orb2564144