Products 59652-88-9
CAS 59652-88-9 appears in our catalog under these names: 2,4,6-Triethoxybenzaldehyde, 95%, 2,4,6-Triethoxybenzaldehyde, 97%, Phloroglucinol aldehyde triethyl ether, Phloroglucinol aldehyde triethyl ether, min. 95 %, 250 mg, Phloroglucinol aldehyde triethyl ether, min. 95 %, 500 mg. Offered by: Combi-blocks, AmBeed, Biosynth, Roth. Available pack sizes: 1g, 100g, 25g, 5g, 0,5g, 2g, 250mg, 500mg.
2,4,6-triethoxybenzaldehyde (CAS 59652-88-9) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 2,4,6-triethoxybenzaldehyde. InChIKey: FXNZCYUMRHJSFP-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2,4,6-triethoxybenzaldehyde |
| InChIKey | FXNZCYUMRHJSFP-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1)OCC)C=O)OCC |
Computed by PubChem (NCBI)