Products 2969486-73-3

CAS 2969486-73-3 is the registry number for 2-fluoro-3-(trifluoromethyl)phenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

[2-fluoro-3-(trifluoromethyl)phenyl] acetate (CAS 2969486-73-3) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: [2-fluoro-3-(trifluoromethyl)phenyl] acetate. InChIKey: PWOZKCOQHDMNJE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F4O2
Molecular weight222.14 g/mol
IUPAC name[2-fluoro-3-(trifluoromethyl)phenyl] acetate
InChIKeyPWOZKCOQHDMNJE-UHFFFAOYSA-N
SMILESCC(=O)OC1=CC=CC(=C1F)C(F)(F)F

Computed by PubChem (NCBI)