CAS 2970213-45-5 appears in our catalog under these names: 3-(2-bromo-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl)piperidine-2,6-dione, 95%, CRBN ligand-735. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-(2-bromo-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl)piperidine-2,6-dione (CAS 2970213-45-5) is a chemical compound with the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. IUPAC name: 3-(2-bromo-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl)piperidine-2,6-dione. InChIKey: QDEKQJOKQRBMHL-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3S |
|---|---|
| Molecular weight | 343.20 g/mol |
| IUPAC name | 3-(2-bromo-7-oxo-4,5-dihydrothieno[2,3-c]pyridin-6-yl)piperidine-2,6-dione |
| InChIKey | QDEKQJOKQRBMHL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CCC3=C(C2=O)SC(=C3)Br |
Computed by PubChem (NCBI)