CAS 97120-13-3 is the registry number for BBMP. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, Get quote.
5-benzylsulfonyl-4-bromo-2-methylpyridazin-3-one (CAS 97120-13-3) is a chemical compound with the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. IUPAC name: 5-benzylsulfonyl-4-bromo-2-methylpyridazin-3-one. InChIKey: ICJYBAMRYLSLQT-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3S |
|---|---|
| Molecular weight | 343.20 g/mol |
| IUPAC name | 5-benzylsulfonyl-4-bromo-2-methylpyridazin-3-one |
| InChIKey | ICJYBAMRYLSLQT-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C=N1)S(=O)(=O)CC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)