CAS 29723-63-5 appears in our catalog under these names: (Phenyl)(ethyl)imino-λ6-sulfanone, 95-<97%, Ethyl(imino)(4-methylphenyl)-lambda6-sulfanone, 95%, S-​Ethyl-​S-​(4-​methylphenyl)​-sulfoximine. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 0,5g, 50mg.
Ethyl-imino-(4-methylphenyl)-oxo-lambda6-sulfane (CAS 29723-63-5) is a chemical compound with the molecular formula C9H13NOS and a molecular weight of 183.27 g/mol. IUPAC name: ethyl-imino-(4-methylphenyl)-oxo-lambda6-sulfane. InChIKey: JODYLFWNTQXLNT-UHFFFAOYSA-N.
| Molecular formula | C9H13NOS |
|---|---|
| Molecular weight | 183.27 g/mol |
| IUPAC name | ethyl-imino-(4-methylphenyl)-oxo-lambda6-sulfane |
| InChIKey | JODYLFWNTQXLNT-UHFFFAOYSA-N |
| SMILES | CCS(=N)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)