CAS 2973-19-5 appears in our catalog under these names: 2-Hydroxy-5-nitrobenzyl Chloride, Phenol, 2-(chloromethyl)-4-nitro-, 96%. Offered by: TRC, Fluorochem. Available pack sizes: 1g, 2,5g, 500mg, 10g.
2-(chloromethyl)-4-nitrophenol (CAS 2973-19-5) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 2-(chloromethyl)-4-nitrophenol. InChIKey: PJNPZIYGODMAQE-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-(chloromethyl)-4-nitrophenol |
| InChIKey | PJNPZIYGODMAQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CCl)O |
Computed by PubChem (NCBI)