CAS 2976-71-8 is the registry number for 4-(Benzylthio)aniline, 97%. Offered by: AmBeed. Available pack sizes: 10g.
4-benzylsulfanylaniline (CAS 2976-71-8) is a chemical compound with the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. IUPAC name: 4-benzylsulfanylaniline. InChIKey: ARKMPBRPOSHHJR-UHFFFAOYSA-N.
| Molecular formula | C13H13NS |
|---|---|
| Molecular weight | 215.32 g/mol |
| IUPAC name | 4-benzylsulfanylaniline |
| InChIKey | ARKMPBRPOSHHJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)