CAS 84212-05-5 is the registry number for (4-(Phenylsulfanyl)phenyl)methanamine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4-phenylsulfanylphenyl)methanamine (CAS 84212-05-5) is a chemical compound with the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. IUPAC name: (4-phenylsulfanylphenyl)methanamine. InChIKey: OEDXLXUXHSCZKP-UHFFFAOYSA-N.
| Molecular formula | C13H13NS |
|---|---|
| Molecular weight | 215.32 g/mol |
| IUPAC name | (4-phenylsulfanylphenyl)methanamine |
| InChIKey | OEDXLXUXHSCZKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)