Products 298216-87-2

CAS 298216-87-2 is the registry number for 4-(3-Benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid (CAS 298216-87-2) is a chemical compound with the molecular formula C17H15NO3S and a molecular weight of 313.4 g/mol. IUPAC name: 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid. InChIKey: NOJPLFKBINIONR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15NO3S
Molecular weight313.4 g/mol
IUPAC name4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid
InChIKeyNOJPLFKBINIONR-UHFFFAOYSA-N
SMILESC1C(=O)N(C(S1)C2=CC=C(C=C2)C(=O)O)CC3=CC=CC=C3

Computed by PubChem (NCBI)