CAS 298216-87-2 is the registry number for 4-(3-Benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid (CAS 298216-87-2) is a chemical compound with the molecular formula C17H15NO3S and a molecular weight of 313.4 g/mol. IUPAC name: 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid. InChIKey: NOJPLFKBINIONR-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3S |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)benzoic acid |
| InChIKey | NOJPLFKBINIONR-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(S1)C2=CC=C(C=C2)C(=O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)