Products 803703-26-6
CAS 803703-26-6 is the registry number for 3-(4-ethoxyphenyl)-2-(phenylsulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-(benzenesulfonyl)-3-(4-ethoxyphenyl)prop-2-enenitrile (CAS 803703-26-6) is a chemical compound with the molecular formula C17H15NO3S and a molecular weight of 313.4 g/mol. IUPAC name: (Z)-2-(benzenesulfonyl)-3-(4-ethoxyphenyl)prop-2-enenitrile. InChIKey: JHEUXRRJTCZMNZ-ATVHPVEESA-N.
| Molecular formula | C17H15NO3S |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | (Z)-2-(benzenesulfonyl)-3-(4-ethoxyphenyl)prop-2-enenitrile |
| InChIKey | JHEUXRRJTCZMNZ-ATVHPVEESA-N |
| SMILES | CCOC1=CC=C(C=C1)/C=C(/C#N)\S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)