Products 2983878-00-6
CAS 2983878-00-6 is the registry number for 2-(2-Methoxydibenzo[b,d]furan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(2-methoxydibenzofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2983878-00-6) is a chemical compound with the molecular formula C19H21BO4 and a molecular weight of 324.2 g/mol. IUPAC name: 2-(2-methoxydibenzofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SLSMVAJYIJSMSR-UHFFFAOYSA-N.
| Molecular formula | C19H21BO4 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 2-(2-methoxydibenzofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SLSMVAJYIJSMSR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2OC)C4=CC=CC=C4O3 |
Computed by PubChem (NCBI)