CAS 2490666-01-6 is the registry number for 4-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]benzaldehyde (CAS 2490666-01-6) is a chemical compound with the molecular formula C19H21BO4 and a molecular weight of 324.2 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]benzaldehyde. InChIKey: IDJVHXFOOPZUEP-UHFFFAOYSA-N.
| Molecular formula | C19H21BO4 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]benzaldehyde |
| InChIKey | IDJVHXFOOPZUEP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)