CAS 2377608-22-3 appears in our catalog under these names: 3-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoic acid, 96%, 4'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoic acid (CAS 2377608-22-3) is a chemical compound with the molecular formula C19H21BO4 and a molecular weight of 324.2 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoic acid. InChIKey: UPOQGPGGAUMBAT-UHFFFAOYSA-N.
| Molecular formula | C19H21BO4 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzoic acid |
| InChIKey | UPOQGPGGAUMBAT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)