Products 2985-39-9
CAS 2985-39-9 appears in our catalog under these names: 2-(Ethoxycarbonyl)-3-phenylpropanoic acid, 95%, 2–Benzyl–3–ethoxy–3–oxopropanoic acid, 2-Benzyl-3-ethoxy-3-oxopropanoic acid 97%, 2-Benzyl-3-ethoxy-3-oxopropanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-benzyl-3-ethoxy-3-oxopropanoic acid (CAS 2985-39-9) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 2-benzyl-3-ethoxy-3-oxopropanoic acid. InChIKey: KDDBSOXJYRJAGU-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-benzyl-3-ethoxy-3-oxopropanoic acid |
| InChIKey | KDDBSOXJYRJAGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-benzyl-malonic acid monoethyl ester, 2-benzyl-3-ethoxy-3-oxopropanoic acid, Benzylmalonic acid monoethyl ester, 2-(Ethoxycarbonyl)-3-phenylpropanoic acid, ChemDiv2_000510, Propanedioic acid, 2-(phenylmethyl)-, 1-ethyl ester, Oprea1_084437, 2-benzylmalonic acid ethyl ester, KDDBSOXJYRJAGU-UHFFFAOYSA-N, benzylmalonic acid mono ethyl ester