CAS 2986178-13-4 is the registry number for (alphaS)-alpha-(((2-(4-Aminophenyl)ethyl)amino)methyl)benzenemethanol Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(1S)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol;hydrochloride (CAS 2986178-13-4) is a chemical compound with the molecular formula C16H21ClN2O and a molecular weight of 292.80 g/mol. IUPAC name: (1S)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol;hydrochloride. InChIKey: QILVTBCJVNFIDP-PKLMIRHRSA-N.
| Molecular formula | C16H21ClN2O |
|---|---|
| Molecular weight | 292.80 g/mol |
| IUPAC name | (1S)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol;hydrochloride |
| InChIKey | QILVTBCJVNFIDP-PKLMIRHRSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CNCCC2=CC=C(C=C2)N)O.Cl |
Computed by PubChem (NCBI)