CAS 521284-22-0 appears in our catalog under these names: (R)-2-((4-Aminophenethyl)amino)-1-phenylethanol Hydrochloride, >95% (HPLC), (R)-2-((4-Aminophenethyl)amino)-1-phenylethanol hydrochloride, (R)-2-((4-Aminophenethyl)amino)-1-phenylethanol hydrochloride, 98%, 98%, MIRABEGRON RELATED COMPOUND A, (R)-2-((4-Aminophenethyl)amino)-1-phenylethanol hydrochloride, 98%. Offered by: TRC, Biosynth, Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 50g, 100g, 250g, 250mg.
(1R)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol;hydrochloride (CAS 521284-22-0) is a chemical compound with the molecular formula C16H21ClN2O and a molecular weight of 292.80 g/mol. IUPAC name: (1R)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol;hydrochloride. InChIKey: QILVTBCJVNFIDP-NTISSMGPSA-N.
| Molecular formula | C16H21ClN2O |
|---|---|
| Molecular weight | 292.80 g/mol |
| IUPAC name | (1R)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol;hydrochloride |
| InChIKey | QILVTBCJVNFIDP-NTISSMGPSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CNCCC2=CC=C(C=C2)N)O.Cl |
Computed by PubChem (NCBI)