Products 2986647-41-8
CAS 2986647-41-8 is the registry number for CRM1 degrader 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-2,3-dihydropyran-6-one (CAS 2986647-41-8) is a chemical compound with the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. IUPAC name: (2R)-2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-2,3-dihydropyran-6-one. InChIKey: CHFFVRWPHNFFIX-CYBMUJFWSA-N.
| Molecular formula | C16H20O3 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | (2R)-2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-2,3-dihydropyran-6-one |
| InChIKey | CHFFVRWPHNFFIX-CYBMUJFWSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C)C)OC[C@H]2CC=CC(=O)O2 |
Computed by PubChem (NCBI)