Products 29870-28-8
CAS 29870-28-8 is the registry number for 2-(dimethylamino)ethanol (2R,3R)-2,3-dihydroxybutanedioate, ≥98.0%, ≥98.0%. Offered by: Chemat. Available pack sizes: 100g.
(2R,3R)-2,3-dihydroxybutanedioic acid;2-(dimethylamino)ethanol (CAS 29870-28-8) is a chemical compound with the molecular formula C8H17NO7 and a molecular weight of 239.22 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;2-(dimethylamino)ethanol. InChIKey: UIEGYKVRCKDVKQ-LREBCSMRSA-N.
| Molecular formula | C8H17NO7 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;2-(dimethylamino)ethanol |
| InChIKey | UIEGYKVRCKDVKQ-LREBCSMRSA-N |
| SMILES | CN(C)CCO.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)