CAS 5988-51-2 appears in our catalog under these names: 2-Dimethylaminoethanol Bitartrate, 2-Dimethylaminoethanol L-Tartrate, 2–Dimethylaminoethanol (+)–bitartrate salt, 2-Dimethylaminoethanol (+)-bitartrate salt, 2-DIMETHYLAMINOETHANOL (+)-BITARTRATE S&. Offered by: TRC, Chemat Brand, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100g, 250g, 25g, on request, 50g, 25kg.
(2R,3R)-2,3-dihydroxybutanedioic acid;2-(dimethylamino)ethanol (CAS 5988-51-2) is a chemical compound with the molecular formula C8H17NO7 and a molecular weight of 239.22 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;2-(dimethylamino)ethanol. InChIKey: UIEGYKVRCKDVKQ-LREBCSMRSA-N.
| Molecular formula | C8H17NO7 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;2-(dimethylamino)ethanol |
| InChIKey | UIEGYKVRCKDVKQ-LREBCSMRSA-N |
| SMILES | CN(C)CCO.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)