Products 2987726-27-0
CAS 2987726-27-0 is the registry number for STAT3-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[7-(3,5-dimethoxyanilino)-5-(2-methylpyrazol-3-yl)-1-benzofuran-2-yl]ethanone (CAS 2987726-27-0) is a chemical compound with the molecular formula C22H21N3O4 and a molecular weight of 391.4 g/mol. IUPAC name: 1-[7-(3,5-dimethoxyanilino)-5-(2-methylpyrazol-3-yl)-1-benzofuran-2-yl]ethanone. InChIKey: PWYYKSMCHFQAGF-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O4 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | 1-[7-(3,5-dimethoxyanilino)-5-(2-methylpyrazol-3-yl)-1-benzofuran-2-yl]ethanone |
| InChIKey | PWYYKSMCHFQAGF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=CC(=CC(=C2O1)NC3=CC(=CC(=C3)OC)OC)C4=CC=NN4C |
Computed by PubChem (NCBI)