CAS 2988668-59-1 is the registry number for Fmoc-D-Gly(adamantyl)-OH. Offered by: Iris Biotech. Available pack sizes: 5g.
(2R)-2-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 2988668-59-1) is a chemical compound with the molecular formula C27H29NO4 and a molecular weight of 431.5 g/mol. IUPAC name: (2R)-2-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: YKDNBNMLFPFDRJ-VHPSJOIFSA-N.
| Molecular formula | C27H29NO4 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2R)-2-(1-adamantyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | YKDNBNMLFPFDRJ-VHPSJOIFSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)