Products 2990018-57-8
CAS 2990018-57-8 appears in our catalog under these names: RP101988, RP101988, 98.80%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 10mM/1mL, 50 mg, 5 mg, 10 mg.
2-[[(1S)-4-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]acetic acid (CAS 2990018-57-8) is a chemical compound with the molecular formula C23H22N4O4 and a molecular weight of 418.4 g/mol. IUPAC name: 2-[[(1S)-4-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]acetic acid. InChIKey: HICWSCLKDYAXPD-IBGZPJMESA-N.
| Molecular formula | C23H22N4O4 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 2-[[(1S)-4-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]acetic acid |
| InChIKey | HICWSCLKDYAXPD-IBGZPJMESA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C2=NC(=NO2)C3=C4CC[C@@H](C4=CC=C3)NCC(=O)O)C#N |
Computed by PubChem (NCBI)
Synonyms:
orb1744230, orb1818563