Products 29938-71-4
CAS 29938-71-4 is the registry number for (5-Chloro-1,3-dimethyl-1H-pyrazol-4-yl)(2-fluorophenyl)methanone. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
(5-chloro-1,3-dimethylpyrazol-4-yl)-(2-fluorophenyl)methanone (CAS 29938-71-4) is a chemical compound with the molecular formula C12H10ClFN2O and a molecular weight of 252.67 g/mol. IUPAC name: (5-chloro-1,3-dimethylpyrazol-4-yl)-(2-fluorophenyl)methanone. InChIKey: PHVXRSPVNINUBA-UHFFFAOYSA-N.
| Molecular formula | C12H10ClFN2O |
|---|---|
| Molecular weight | 252.67 g/mol |
| IUPAC name | (5-chloro-1,3-dimethylpyrazol-4-yl)-(2-fluorophenyl)methanone |
| InChIKey | PHVXRSPVNINUBA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C(=O)C2=CC=CC=C2F)Cl)C |
Computed by PubChem (NCBI)