CAS 29939-31-9 is the registry number for 2,4-Di-tert-butylpyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-ditert-butylpyridine (CAS 29939-31-9) is a chemical compound with the molecular formula C13H21N and a molecular weight of 191.31 g/mol. IUPAC name: 2,4-ditert-butylpyridine. InChIKey: LEOBMIVTCWKNCB-UHFFFAOYSA-N.
| Molecular formula | C13H21N |
|---|---|
| Molecular weight | 191.31 g/mol |
| IUPAC name | 2,4-ditert-butylpyridine |
| InChIKey | LEOBMIVTCWKNCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC=C1)C(C)(C)C |
Computed by PubChem (NCBI)