Products 2995282-43-2
CAS 2995282-43-2 is the registry number for 6-Methyl-1-(2,4,5-trifluorobenzyl)pyrimidine-2,4(1H,3H)-dione, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-methyl-1-[(2,4,5-trifluorophenyl)methyl]pyrimidine-2,4-dione (CAS 2995282-43-2) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 6-methyl-1-[(2,4,5-trifluorophenyl)methyl]pyrimidine-2,4-dione. InChIKey: OFZCRNNSTUBDGU-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 6-methyl-1-[(2,4,5-trifluorophenyl)methyl]pyrimidine-2,4-dione |
| InChIKey | OFZCRNNSTUBDGU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=O)N1CC2=CC(=C(C=C2F)F)F |
Computed by PubChem (NCBI)