Products 299928-52-2
CAS 299928-52-2 is the registry number for 4-Bromo-N-(quinolin-8-yl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
4-bromo-N-quinolin-8-ylbenzamide (CAS 299928-52-2) is a chemical compound with the molecular formula C16H11BrN2O and a molecular weight of 327.17 g/mol. IUPAC name: 4-bromo-N-quinolin-8-ylbenzamide. InChIKey: LKDOLFCMFMGHKE-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2O |
|---|---|
| Molecular weight | 327.17 g/mol |
| IUPAC name | 4-bromo-N-quinolin-8-ylbenzamide |
| InChIKey | LKDOLFCMFMGHKE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NC(=O)C3=CC=C(C=C3)Br)N=CC=C2 |
Computed by PubChem (NCBI)