CAS 30007-47-7 appears in our catalog under these names: 5-Bromo-5-nitro-1,3-dioxane, 98%, 5-Bromo-5-Nitro-1,3-Dioxane, Bronidox, 5-Bromo-5-nitro-1,3-dioxane/ 99.87% (existing batch purity), 5–bromo–5–nitro–1,3–Dioxane. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 100g, 25g, 500g, 5g, on request, 2,5g, 250mg, 1g.
5-bromo-5-nitro-1,3-dioxane (CAS 30007-47-7) is a chemical compound with the molecular formula C4H6BrNO4 and a molecular weight of 212.00 g/mol. IUPAC name: 5-bromo-5-nitro-1,3-dioxane. InChIKey: XVBRCOKDZVQYAY-UHFFFAOYSA-N.
| Molecular formula | C4H6BrNO4 |
|---|---|
| Molecular weight | 212.00 g/mol |
| IUPAC name | 5-bromo-5-nitro-1,3-dioxane |
| InChIKey | XVBRCOKDZVQYAY-UHFFFAOYSA-N |
| SMILES | C1C(COCO1)([N+](=O)[O-])Br |
Computed by PubChem (NCBI)