CAS 6060-97-5 is the registry number for Ethylbromonitroacetate. Offered by: TRC. Available pack sizes: 25mg.
Ethyl 2-bromo-2-nitroacetate (CAS 6060-97-5) is a chemical compound with the molecular formula C4H6BrNO4 and a molecular weight of 212.00 g/mol. IUPAC name: ethyl 2-bromo-2-nitroacetate. InChIKey: LWSZLBNYFWTRQY-UHFFFAOYSA-N.
| Molecular formula | C4H6BrNO4 |
|---|---|
| Molecular weight | 212.00 g/mol |
| IUPAC name | ethyl 2-bromo-2-nitroacetate |
| InChIKey | LWSZLBNYFWTRQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C([N+](=O)[O-])Br |
Computed by PubChem (NCBI)