CAS 300552-41-4 is the registry number for 7-Benzyl-4-chloro-2-methyl-5,6,7,8-tetrahydropyrido(3,4-d)pyrimidine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
7-benzyl-4-chloro-2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (CAS 300552-41-4) is a chemical compound with the molecular formula C15H16ClN3 and a molecular weight of 273.76 g/mol. IUPAC name: 7-benzyl-4-chloro-2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine. InChIKey: GEXUISQJUDFACP-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3 |
|---|---|
| Molecular weight | 273.76 g/mol |
| IUPAC name | 7-benzyl-4-chloro-2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| InChIKey | GEXUISQJUDFACP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(CCN(C2)CC3=CC=CC=C3)C(=N1)Cl |
Computed by PubChem (NCBI)