CAS 374064-08-1 is the registry number for 2-(2-Pyridin-2-yl-1h-indol-3-yl)ethanamine monohydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
2-(2-pyridin-2-yl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 374064-08-1) is a chemical compound with the molecular formula C15H16ClN3 and a molecular weight of 273.76 g/mol. IUPAC name: 2-(2-pyridin-2-yl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: ZUDXMPIFLYFHNW-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3 |
|---|---|
| Molecular weight | 273.76 g/mol |
| IUPAC name | 2-(2-pyridin-2-yl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | ZUDXMPIFLYFHNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C3=CC=CC=N3)CCN.Cl |
Computed by PubChem (NCBI)