Products 300588-68-5

CAS 300588-68-5 is the registry number for 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl phenylacetate. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

(2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenylacetate (CAS 300588-68-5) is a chemical compound with the molecular formula C20H21NO2 and a molecular weight of 307.4 g/mol. IUPAC name: (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenylacetate. InChIKey: VHFBMAKHNZTQAA-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO2
Molecular weight307.4 g/mol
IUPAC name(2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenylacetate
InChIKeyVHFBMAKHNZTQAA-UHFFFAOYSA-N
SMILESCC1=CC(NC2=C1C=C(C=C2)OC(=O)CC3=CC=CC=C3)(C)C

Computed by PubChem (NCBI)