CAS 300588-68-5 is the registry number for 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl phenylacetate. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg, 10000mg.
(2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenylacetate (CAS 300588-68-5) is a chemical compound with the molecular formula C20H21NO2 and a molecular weight of 307.4 g/mol. IUPAC name: (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenylacetate. InChIKey: VHFBMAKHNZTQAA-UHFFFAOYSA-N.
| Molecular formula | C20H21NO2 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (2,2,4-trimethyl-1H-quinolin-6-yl) 2-phenylacetate |
| InChIKey | VHFBMAKHNZTQAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)OC(=O)CC3=CC=CC=C3)(C)C |
Computed by PubChem (NCBI)