CAS 300712-55-4 is the registry number for 1-Tosyl-1,4-diazepan-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methylphenyl)sulfonyl-1,4-diazepan-5-one (CAS 300712-55-4) is a chemical compound with the molecular formula C12H16N2O3S and a molecular weight of 268.33 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-1,4-diazepan-5-one. InChIKey: BUBDJPVDFJRANO-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-1,4-diazepan-5-one |
| InChIKey | BUBDJPVDFJRANO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(=O)NCC2 |
Computed by PubChem (NCBI)