CAS 300727-89-3 is the registry number for Sulfasalazine Impurity 21. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-chloro-N-(5-chloro-2-pyridinyl)benzenesulfonamide (CAS 300727-89-3) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: 4-chloro-N-(5-chloro-2-pyridinyl)benzenesulfonamide. InChIKey: MDOYUBLKTKFVIF-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 4-chloro-N-(5-chloro-2-pyridinyl)benzenesulfonamide |
| InChIKey | MDOYUBLKTKFVIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NC2=NC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)