Products 300727-89-3

CAS 300727-89-3 is the registry number for Sulfasalazine Impurity 21. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-chloro-N-(5-chloro-2-pyridinyl)benzenesulfonamide (CAS 300727-89-3) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: 4-chloro-N-(5-chloro-2-pyridinyl)benzenesulfonamide. InChIKey: MDOYUBLKTKFVIF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8Cl2N2O2S
Molecular weight303.2 g/mol
IUPAC name4-chloro-N-(5-chloro-2-pyridinyl)benzenesulfonamide
InChIKeyMDOYUBLKTKFVIF-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1S(=O)(=O)NC2=NC=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)