CAS 400776-22-9 is the registry number for Ethyl 2-(2,6-dichloropyridin-4-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2,6-dichloro-4-pyridinyl)-1,3-thiazole-4-carboxylate (CAS 400776-22-9) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: ethyl 2-(2,6-dichloro-4-pyridinyl)-1,3-thiazole-4-carboxylate. InChIKey: LXAYUEVMLBAANN-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | ethyl 2-(2,6-dichloro-4-pyridinyl)-1,3-thiazole-4-carboxylate |
| InChIKey | LXAYUEVMLBAANN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC(=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)