CAS 300814-88-4 appears in our catalog under these names: 2-(2-Amino-4-(thiophen-2-yl)thiazol-5-yl)acetic acid, 95%, 2-(2-Amino-4-(thiophen-2-yl)thiazol-5-yl)acetic acid, 95+%, (2-Amino-4-thiophen-2-yl-thiazol-5-yl)-acetic acid, 2-(2-Amino-4-(thiophen-2-yl)thiazol-5-yl)acetic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 2,5g.
2-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid (CAS 300814-88-4) is a chemical compound with the molecular formula C9H8N2O2S2 and a molecular weight of 240.3 g/mol. IUPAC name: 2-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid. InChIKey: DSGCQCIYLMWRBL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S2 |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | 2-(2-amino-4-thiophen-2-yl-1,3-thiazol-5-yl)acetic acid |
| InChIKey | DSGCQCIYLMWRBL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=C(SC(=N2)N)CC(=O)O |
Computed by PubChem (NCBI)