CAS 80337-72-0 is the registry number for Methyl 2'-methyl-[2,4'-bithiazole]-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate (CAS 80337-72-0) is a chemical compound with the molecular formula C9H8N2O2S2 and a molecular weight of 240.3 g/mol. IUPAC name: methyl 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate. InChIKey: OTYVVTDWXXKIMD-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S2 |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | methyl 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylate |
| InChIKey | OTYVVTDWXXKIMD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=NC(=CS2)C(=O)OC |
Computed by PubChem (NCBI)