CAS 300852-00-0 appears in our catalog under these names: [4-(4-Nitro-phenyl)-thiazol-2-yl]-m-tolyl-amine, 95%, N-(3-Methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(3-methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine (CAS 300852-00-0) is a chemical compound with the molecular formula C16H13N3O2S and a molecular weight of 311.4 g/mol. IUPAC name: N-(3-methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine. InChIKey: UHNKITHQUBXBJC-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | N-(3-methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| InChIKey | UHNKITHQUBXBJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=NC(=CS2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)