Products 893778-65-9
CAS 893778-65-9 is the registry number for N-(5-Benzyl-1,3,4-thiadiazol-2-yl)-2-hydroxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-hydroxybenzamide (CAS 893778-65-9) is a chemical compound with the molecular formula C16H13N3O2S and a molecular weight of 311.4 g/mol. IUPAC name: N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-hydroxybenzamide. InChIKey: JLALEEJFOZHLRK-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-2-hydroxybenzamide |
| InChIKey | JLALEEJFOZHLRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NN=C(S2)NC(=O)C3=CC=CC=C3O |
Computed by PubChem (NCBI)